C23H22F6N2O5S — CID 157046300
(1S)-2-acetyl-6-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 157046300) has the molecular formula C23H22F6N2O5S and a molecular weight of 552.49 g/mol. Its IUPAC name is (1S)-2-acetyl-6-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | (1S)-2-acetyl-6-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 157046300 |
| Molecular Formula | C23H22F6N2O5S |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | (1S)-2-acetyl-6-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)CCN(C(C)=O)[C@@H]2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22F6N2O5S/c1-3-37(35,36)17-8-9-18-14(12-17)10-11-31(13(2)32)19(18)20(33)30-16-6-4-15(5-7-16)21(34,22(24,25)26)23(27,28)29/h4-9,12,19,34H,3,10-11H2,1-2H3,(H,30,33)/t19-/m0/s1 |
| InChIKey | PSXLNOBZVCFYBO-IBGZPJMESA-N |
| XLogP | 3.88 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |