C26H27F6N3O5S — CID 146473604
2-acetyl-N-[4-[1,1,1,3,3,3-hexafluoro-2-(oxan-4-ylamino)propan-2-yl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide (PubChem CID 146473604) has the molecular formula C26H27F6N3O5S and a molecular weight of 607.57 g/mol. Its IUPAC name is 2-acetyl-N-[4-[1,1,1,3,3,3-hexafluoro-2-(oxan-4-ylamino)propan-2-yl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 2-acetyl-N-[4-[1,1,1,3,3,3-hexafluoro-2-(oxan-4-ylamino)propan-2-yl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 146473604 |
| Molecular Formula | C26H27F6N3O5S |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | 2-acetyl-N-[4-[1,1,1,3,3,3-hexafluoro-2-(oxan-4-ylamino)propan-2-yl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CC(=O)N1Cc2cc(S(C)(=O)=O)ccc2C1C(=O)Nc1ccc(C(NC2CCOCC2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H27F6N3O5S/c1-15(36)35-14-16-13-20(41(2,38)39)7-8-21(16)22(35)23(37)33-18-5-3-17(4-6-18)24(25(27,28)29,26(30,31)32)34-19-9-11-40-12-10-19/h3-8,13,19,22,34H,9-12,14H2,1-2H3,(H,33,37) |
| InChIKey | URRHOUUUPBCOTM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |