C22H18F6N6O5S — CID 137362899
1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylic acid (PubChem CID 137362899) has the molecular formula C22H18F6N6O5S and a molecular weight of 592.48 g/mol. Its IUPAC name is 1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylic acid.
| Compound Name | 1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 137362899 |
| Molecular Formula | C22H18F6N6O5S |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | 1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylic acid |
| SMILES | Cn1nnc(C(c2ccc(NC(=O)C3c4ccc(S(C)(=O)=O)cc4CN3C(=O)O)cc2)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C22H18F6N6O5S/c1-33-31-18(30-32-33)20(21(23,24)25,22(26,27)28)12-3-5-13(6-4-12)29-17(35)16-15-8-7-14(40(2,38)39)9-11(15)10-34(16)19(36)37/h3-9,16H,10H2,1-2H3,(H,29,35)(H,36,37) |
| InChIKey | BKJOQQNGCWLETG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |