C22H16F6N6O5S — CID 137362898
1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylic acid (PubChem CID 137362898) has the molecular formula C22H16F6N6O5S and a molecular weight of 590.46 g/mol. Its IUPAC name is 1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylic acid.
| Compound Name | 1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 137362898 |
| Molecular Formula | C22H16F6N6O5S |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | 1-[[4-[1,1,1,3,3,3-hexafluoro-2-(2-methyltetrazol-5-yl)propan-2-yl]phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylic acid |
| SMILES | Cn1nnc(C(c2ccc(NC(=O)c3c4ccc(S(C)(=O)=O)cc4cn3C(=O)O)cc2)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C22H16F6N6O5S/c1-33-31-18(30-32-33)20(21(23,24)25,22(26,27)28)12-3-5-13(6-4-12)29-17(35)16-15-8-7-14(40(2,38)39)9-11(15)10-34(16)19(36)37/h3-10H,1-2H3,(H,29,35)(H,36,37) |
| InChIKey | BDJRMAHFRXCZQJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |