C23H22F6N2O6S — CID 175154311
3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-3-propan-2-yl-1H-isoindole-2-carboxylic acid (PubChem CID 175154311) has the molecular formula C23H22F6N2O6S and a molecular weight of 568.49 g/mol. Its IUPAC name is 3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-3-propan-2-yl-1H-isoindole-2-carboxylic acid.
| Compound Name | 3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-3-propan-2-yl-1H-isoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 175154311 |
| Molecular Formula | C23H22F6N2O6S |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-3-propan-2-yl-1H-isoindole-2-carboxylic acid |
| SMILES | CC(C)C1(C(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c2ccc(S(C)(=O)=O)cc2CN1C(=O)O |
| InChI | InChI=1S/C23H22F6N2O6S/c1-12(2)20(17-9-8-16(38(3,36)37)10-13(17)11-31(20)19(33)34)18(32)30-15-6-4-14(5-7-15)21(35,22(24,25)26)23(27,28)29/h4-10,12,35H,11H2,1-3H3,(H,30,32)(H,33,34) |
| InChIKey | YBTQLLZSXSXKNG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |