C19H16F6N2O4S — CID 154037512
1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2,3-dihydroisoindole-1-carboxamide (PubChem CID 154037512) has the molecular formula C19H16F6N2O4S and a molecular weight of 482.40 g/mol. Its IUPAC name is 1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2,3-dihydroisoindole-1-carboxamide.
| Compound Name | 1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 154037512 |
| Molecular Formula | C19H16F6N2O4S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2,3-dihydroisoindole-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CNC2(C(N)=O)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F6N2O4S/c1-32(30,31)13-6-7-14-10(8-13)9-27-16(14,15(26)28)11-2-4-12(5-3-11)17(29,18(20,21)22)19(23,24)25/h2-8,27,29H,9H2,1H3,(H2,26,28) |
| InChIKey | ICXJFJOIDULAAQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |