C20H17F7N2O4S — CID 157046290
N-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 157046290) has the molecular formula C20H17F7N2O4S and a molecular weight of 514.42 g/mol. Its IUPAC name is N-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | N-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 157046290 |
| Molecular Formula | C20H17F7N2O4S |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | N-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCNC2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C20H17F7N2O4S/c1-34(32,33)12-3-4-13-10(8-12)6-7-28-16(13)17(30)29-15-5-2-11(9-14(15)21)18(31,19(22,23)24)20(25,26)27/h2-5,8-9,16,28,31H,6-7H2,1H3,(H,29,30) |
| InChIKey | ZEJCJYUOOUSUEQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |