C26H21F7N2O2S — CID 166846831
N-[3-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-6-methylsulfanyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 166846831) has the molecular formula C26H21F7N2O2S and a molecular weight of 558.52 g/mol. Its IUPAC name is N-[3-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-6-methylsulfanyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | N-[3-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-6-methylsulfanyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 166846831 |
| Molecular Formula | C26H21F7N2O2S |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N-[3-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-6-methylsulfanyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | CSc1ccc2c(c1)CCNC2C(=O)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C26H21F7N2O2S/c1-38-18-7-9-20-15(12-18)10-11-34-22(20)23(36)35-17-6-8-19(21(27)13-17)14-2-4-16(5-3-14)24(37,25(28,29)30)26(31,32)33/h2-9,12-13,22,34,37H,10-11H2,1H3,(H,35,36) |
| InChIKey | RBTDWWKPLSZOBO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |