C21H24F2N2O2Si — CID 140774152
N-(3,5-difluoro-4-trimethylsilylphenyl)-2,3,6,7,8,9-hexahydrofuro[2,3-f]isoquinoline-6-carboxamide (PubChem CID 140774152) has the molecular formula C21H24F2N2O2Si and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(3,5-difluoro-4-trimethylsilylphenyl)-2,3,6,7,8,9-hexahydrofuro[2,3-f]isoquinoline-6-carboxamide.
| Compound Name | N-(3,5-difluoro-4-trimethylsilylphenyl)-2,3,6,7,8,9-hexahydrofuro[2,3-f]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 140774152 |
| Molecular Formula | C21H24F2N2O2Si |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-(3,5-difluoro-4-trimethylsilylphenyl)-2,3,6,7,8,9-hexahydrofuro[2,3-f]isoquinoline-6-carboxamide |
| SMILES | C[Si](C)(C)c1c(F)cc(NC(=O)C2NCCc3c2ccc2c3OCC2)cc1F |
| InChI | InChI=1S/C21H24F2N2O2Si/c1-28(2,3)20-16(22)10-13(11-17(20)23)25-21(26)18-14-5-4-12-7-9-27-19(12)15(14)6-8-24-18/h4-5,10-11,18,24H,6-9H2,1-3H3,(H,25,26) |
| InChIKey | BMDVQLCEBOVFNB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|