C21H27F2N3O2Si — CID 140897396
(5R)-N-[4-[ethyl(dimethyl)silyl]-3,5-difluorophenyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide (PubChem CID 140897396) has the molecular formula C21H27F2N3O2Si and a molecular weight of 419.55 g/mol. Its IUPAC name is (5R)-N-[4-[ethyl(dimethyl)silyl]-3,5-difluorophenyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide.
| Compound Name | (5R)-N-[4-[ethyl(dimethyl)silyl]-3,5-difluorophenyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 140897396 |
| Molecular Formula | C21H27F2N3O2Si |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (5R)-N-[4-[ethyl(dimethyl)silyl]-3,5-difluorophenyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxamide |
| SMILES | CC[Si](C)(C)c1c(F)cc(NC(=O)[C@@H]2NCCc3nc(COC)ccc32)cc1F |
| InChI | InChI=1S/C21H27F2N3O2Si/c1-5-29(3,4)20-16(22)10-14(11-17(20)23)26-21(27)19-15-7-6-13(12-28-2)25-18(15)8-9-24-19/h6-7,10-11,19,24H,5,8-9,12H2,1-4H3,(H,26,27)/t19-/m1/s1 |
| InChIKey | DCKBLUORWGRCNV-LJQANCHMSA-N |
| XLogP | 3.27 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|