C20H26N2O2Si — CID 140774274
6-methoxy-N-(4-trimethylsilylphenyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 140774274) has the molecular formula C20H26N2O2Si and a molecular weight of 354.53 g/mol. Its IUPAC name is 6-methoxy-N-(4-trimethylsilylphenyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | 6-methoxy-N-(4-trimethylsilylphenyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 140774274 |
| Molecular Formula | C20H26N2O2Si |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 6-methoxy-N-(4-trimethylsilylphenyl)-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | COc1ccc2c(c1)CCNC2C(=O)Nc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O2Si/c1-24-16-7-10-18-14(13-16)11-12-21-19(18)20(23)22-15-5-8-17(9-6-15)25(2,3)4/h5-10,13,19,21H,11-12H2,1-4H3,(H,22,23) |
| InChIKey | DSMNPZNIKHXOOS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|