C26H30F2N2O5Si — CID 154406849
5-[(5R)-5-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-2,3,5,6,7,8-hexahydrofuro[2,3-g]isoquinolin-8-yl]-5-oxopentanoic acid (PubChem CID 154406849) has the molecular formula C26H30F2N2O5Si and a molecular weight of 516.62 g/mol. Its IUPAC name is 5-[(5R)-5-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-2,3,5,6,7,8-hexahydrofuro[2,3-g]isoquinolin-8-yl]-5-oxopentanoic acid.
| Compound Name | 5-[(5R)-5-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-2,3,5,6,7,8-hexahydrofuro[2,3-g]isoquinolin-8-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 154406849 |
| Molecular Formula | C26H30F2N2O5Si |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 5-[(5R)-5-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-2,3,5,6,7,8-hexahydrofuro[2,3-g]isoquinolin-8-yl]-5-oxopentanoic acid |
| SMILES | C[Si](C)(C)c1c(F)cc(NC(=O)[C@@H]2NCC(C(=O)CCCC(=O)O)c3cc4c(cc32)CCO4)cc1F |
| InChI | InChI=1S/C26H30F2N2O5Si/c1-36(2,3)25-19(27)10-15(11-20(25)28)30-26(34)24-17-9-14-7-8-35-22(14)12-16(17)18(13-29-24)21(31)5-4-6-23(32)33/h9-12,18,24,29H,4-8,13H2,1-3H3,(H,30,34)(H,32,33)/t18?,24-/m1/s1 |
| InChIKey | VGYGGVVFESXGPB-VCUSLETLSA-N |
| XLogP | 3.64 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|