C20H30ClNO3 — CID 70395700
7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)octanoic acid;hydrochloride (PubChem CID 70395700) has the molecular formula C20H30ClNO3 and a molecular weight of 367.92 g/mol. Its IUPAC name is 7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)octanoic acid;hydrochloride.
| Compound Name | 7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)octanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70395700 |
| Molecular Formula | C20H30ClNO3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)octanoic acid;hydrochloride |
| SMILES | CC(CCCCCC(=O)O)NC1CCc2cc3c(cc2C1)OCC3.Cl |
| InChI | InChI=1S/C20H29NO3.ClH/c1-14(5-3-2-4-6-20(22)23)21-18-8-7-15-11-16-9-10-24-19(16)13-17(15)12-18;/h11,13-14,18,21H,2-10,12H2,1H3,(H,22,23);1H |
| InChIKey | HQXUNCCRQWUAHT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|