C19H27NO3 — CID 14234819
7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)heptanoic acid (PubChem CID 14234819) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)heptanoic acid.
| Compound Name | 7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)heptanoic acid |
|---|---|
| PubChem CID | 14234819 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 7-(2,3,5,6,7,8-hexahydrobenzo[f][1]benzofuran-7-ylamino)heptanoic acid |
| SMILES | O=C(O)CCCCCCNC1CCc2cc3c(cc2C1)OCC3 |
| InChI | InChI=1S/C19H27NO3/c21-19(22)5-3-1-2-4-9-20-17-7-6-14-11-15-8-10-23-18(15)13-16(14)12-17/h11,13,17,20H,1-10,12H2,(H,21,22) |
| InChIKey | QVVFMWLSOBPQAI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|