C24H34N2O4 — CID 70044263
6-[6-[2-(3,4-dihydroxyphenyl)ethylamino]hexylamino]-5,6,7,8-tetrahydronaphthalene-2,3-diol (PubChem CID 70044263) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 6-[6-[2-(3,4-dihydroxyphenyl)ethylamino]hexylamino]-5,6,7,8-tetrahydronaphthalene-2,3-diol.
| Compound Name | 6-[6-[2-(3,4-dihydroxyphenyl)ethylamino]hexylamino]-5,6,7,8-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 70044263 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 6-[6-[2-(3,4-dihydroxyphenyl)ethylamino]hexylamino]-5,6,7,8-tetrahydronaphthalene-2,3-diol |
| SMILES | Oc1ccc(CCNCCCCCCNC2CCc3cc(O)c(O)cc3C2)cc1O |
| InChI | InChI=1S/C24H34N2O4/c27-21-8-5-17(13-22(21)28)9-12-25-10-3-1-2-4-11-26-20-7-6-18-15-23(29)24(30)16-19(18)14-20/h5,8,13,15-16,20,25-30H,1-4,6-7,9-12,14H2 |
| InChIKey | KLFFUYRCMNSYBY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|