C23H22F6N2O2S — CID 163717336
5-[(1-fluorocyclopropyl)methylsulfanyl]-N-[4-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide (PubChem CID 163717336) has the molecular formula C23H22F6N2O2S and a molecular weight of 504.50 g/mol. Its IUPAC name is 5-[(1-fluorocyclopropyl)methylsulfanyl]-N-[4-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide.
| Compound Name | 5-[(1-fluorocyclopropyl)methylsulfanyl]-N-[4-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 163717336 |
| Molecular Formula | C23H22F6N2O2S |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 5-[(1-fluorocyclopropyl)methylsulfanyl]-N-[4-(1,1,1,3,3-pentafluoro-2-hydroxybutan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
| SMILES | CC(F)(F)C(O)(c1ccc(NC(=O)C2NCc3cc(SCC4(F)CC4)ccc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H22F6N2O2S/c1-20(24,25)22(33,23(27,28)29)14-2-4-15(5-3-14)31-19(32)18-17-7-6-16(10-13(17)11-30-18)34-12-21(26)8-9-21/h2-7,10,18,30,33H,8-9,11-12H2,1H3,(H,31,32) |
| InChIKey | KOMWXSGWZRBCDN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |