C26H28F6N2O5S — CID 165163054
tert-butyl 5-cyclopropylsulfonyl-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]-1,3-dihydroisoindole-2-carboxylate (PubChem CID 165163054) has the molecular formula C26H28F6N2O5S and a molecular weight of 594.57 g/mol. Its IUPAC name is tert-butyl 5-cyclopropylsulfonyl-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-cyclopropylsulfonyl-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 165163054 |
| Molecular Formula | C26H28F6N2O5S |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | tert-butyl 5-cyclopropylsulfonyl-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]methyl]-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(S(=O)(=O)C3CC3)ccc2C1CNc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H28F6N2O5S/c1-23(2,3)39-22(35)34-14-15-12-19(40(37,38)18-8-9-18)10-11-20(15)21(34)13-33-17-6-4-16(5-7-17)24(36,25(27,28)29)26(30,31)32/h4-7,10-12,18,21,33,36H,8-9,13-14H2,1-3H3 |
| InChIKey | YAXQICYUNIXZGO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |