C34H31F3N2O6S — CID 167567210
9H-fluoren-9-ylmethyl 5-ethylsulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]oxy-1,3-dihydroisoindole-2-carboxylate (PubChem CID 167567210) has the molecular formula C34H31F3N2O6S and a molecular weight of 652.69 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 5-ethylsulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]oxy-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 5-ethylsulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]oxy-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 167567210 |
| Molecular Formula | C34H31F3N2O6S |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 5-ethylsulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]oxy-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)CN(C(=O)OCC1c3ccccc3-c3ccccc31)C2ONc1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H31F3N2O6S/c1-3-46(42,43)24-16-17-25-21(18-24)19-39(31(25)45-38-23-14-12-22(13-15-23)33(2,41)34(35,36)37)32(40)44-20-30-28-10-6-4-8-26(28)27-9-5-7-11-29(27)30/h4-18,30-31,38,41H,3,19-20H2,1-2H3 |
| InChIKey | FLBQUYOMVFGZQN-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|