C24H21F7N2O6S — CID 129205193
tert-butyl 1-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylate (PubChem CID 129205193) has the molecular formula C24H21F7N2O6S and a molecular weight of 598.49 g/mol. Its IUPAC name is tert-butyl 1-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylate.
| Compound Name | tert-butyl 1-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylate |
|---|---|
| PubChem CID | 129205193 |
| Molecular Formula | C24H21F7N2O6S |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | tert-butyl 1-[[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonylisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc2cc(S(C)(=O)=O)ccc2c1C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C24H21F7N2O6S/c1-21(2,3)39-20(35)33-11-12-9-14(40(4,37)38)6-7-15(12)18(33)19(34)32-17-8-5-13(10-16(17)25)22(36,23(26,27)28)24(29,30)31/h5-11,36H,1-4H3,(H,32,34) |
| InChIKey | QEQXWDQLCLQABS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |