C21H16F6N2O5S — CID 175163696
2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonylisoindole-1-carboxamide (PubChem CID 175163696) has the molecular formula C21H16F6N2O5S and a molecular weight of 522.42 g/mol. Its IUPAC name is 2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonylisoindole-1-carboxamide.
| Compound Name | 2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonylisoindole-1-carboxamide |
|---|---|
| PubChem CID | 175163696 |
| Molecular Formula | C21H16F6N2O5S |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonylisoindole-1-carboxamide |
| SMILES | CC(=O)n1cc2cc(S(C)(=O)=O)ccc2c1C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F6N2O5S/c1-11(30)29-10-12-9-15(35(2,33)34)7-8-16(12)17(29)18(31)28-14-5-3-13(4-6-14)19(32,20(22,23)24)21(25,26)27/h3-10,32H,1-2H3,(H,28,31) |
| InChIKey | VXPZSPIOAMMOBG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |