C36H28F6N2O7S — CID 175156474
9H-fluoren-9-yl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-(2-methoxyethylsulfonyl)-3-methylisoindole-2-carboxylate (PubChem CID 175156474) has the molecular formula C36H28F6N2O7S and a molecular weight of 746.68 g/mol. Its IUPAC name is 9H-fluoren-9-yl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-(2-methoxyethylsulfonyl)-3-methylisoindole-2-carboxylate.
| Compound Name | 9H-fluoren-9-yl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-(2-methoxyethylsulfonyl)-3-methylisoindole-2-carboxylate |
|---|---|
| PubChem CID | 175156474 |
| Molecular Formula | C36H28F6N2O7S |
| Molecular Weight | 746.68 g/mol |
| Exact Mass | 746.15 |
| IUPAC Name | 9H-fluoren-9-yl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-(2-methoxyethylsulfonyl)-3-methylisoindole-2-carboxylate |
| SMILES | COCCS(=O)(=O)c1ccc2c(C(=O)Nc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)n(C(=O)OC3c4ccccc4-c4ccccc43)c(C)c2c1 |
| InChI | InChI=1S/C36H28F6N2O7S/c1-20-29-19-23(52(48,49)18-17-50-2)15-16-26(29)30(32(45)43-22-13-11-21(12-14-22)34(47,35(37,38)39)36(40,41)42)44(20)33(46)51-31-27-9-5-3-7-24(27)25-8-4-6-10-28(25)31/h3-16,19,31,47H,17-18H2,1-2H3,(H,43,45) |
| InChIKey | GHMJXOHWHBCBNS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |