C23H23F6N3O6S — CID 146623828
2-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-2-N-methyl-1,3-dihydroisoindole-1,2-dicarboxamide (PubChem CID 146623828) has the molecular formula C23H23F6N3O6S and a molecular weight of 583.51 g/mol. Its IUPAC name is 2-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-2-N-methyl-1,3-dihydroisoindole-1,2-dicarboxamide.
| Compound Name | 2-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-2-N-methyl-1,3-dihydroisoindole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 146623828 |
| Molecular Formula | C23H23F6N3O6S |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | 2-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-2-N-methyl-1,3-dihydroisoindole-1,2-dicarboxamide |
| SMILES | COCCS(=O)(=O)c1ccc2c(c1)CN(C(=O)N(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C2C(N)=O |
| InChI | InChI=1S/C23H23F6N3O6S/c1-31(15-5-3-14(4-6-15)21(35,22(24,25)26)23(27,28)29)20(34)32-12-13-11-16(39(36,37)10-9-38-2)7-8-17(13)18(32)19(30)33/h3-8,11,18,35H,9-10,12H2,1-2H3,(H2,30,33) |
| InChIKey | QHUYMSPPAARTFT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |