C35H30F6N2O5S — CID 159146755
2-(9H-fluoren-9-yl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1-methyl-3H-isoindole-1-carboxamide (PubChem CID 159146755) has the molecular formula C35H30F6N2O5S and a molecular weight of 704.69 g/mol. Its IUPAC name is 2-(9H-fluoren-9-yl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1-methyl-3H-isoindole-1-carboxamide.
| Compound Name | 2-(9H-fluoren-9-yl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1-methyl-3H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 159146755 |
| Molecular Formula | C35H30F6N2O5S |
| Molecular Weight | 704.69 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | 2-(9H-fluoren-9-yl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1-methyl-3H-isoindole-1-carboxamide |
| SMILES | COCCS(=O)(=O)c1ccc2c(c1)CN(C1c3ccccc3-c3ccccc31)C2(C)C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H30F6N2O5S/c1-32(31(44)42-23-13-11-22(12-14-23)33(45,34(36,37)38)35(39,40)41)29-16-15-24(49(46,47)18-17-48-2)19-21(29)20-43(32)30-27-9-5-3-7-25(27)26-8-4-6-10-28(26)30/h3-16,19,30,45H,17-18,20H2,1-2H3,(H,42,44) |
| InChIKey | KITUUOAGEXVDOY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.69 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |