C33H24F6N2O6S — CID 129205315
3-(9H-fluoren-9-yl)-3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-1H-isoindole-2-carboxylic acid (PubChem CID 129205315) has the molecular formula C33H24F6N2O6S and a molecular weight of 690.62 g/mol. Its IUPAC name is 3-(9H-fluoren-9-yl)-3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-1H-isoindole-2-carboxylic acid.
| Compound Name | 3-(9H-fluoren-9-yl)-3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-1H-isoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 129205315 |
| Molecular Formula | C33H24F6N2O6S |
| Molecular Weight | 690.62 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | 3-(9H-fluoren-9-yl)-3-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-6-methylsulfonyl-1H-isoindole-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CN(C(=O)O)C2(C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H24F6N2O6S/c1-48(46,47)21-14-15-26-18(16-21)17-41(29(43)44)30(26,27-24-8-4-2-6-22(24)23-7-3-5-9-25(23)27)28(42)40-20-12-10-19(11-13-20)31(45,32(34,35)36)33(37,38)39/h2-16,27,45H,17H2,1H3,(H,40,42)(H,43,44) |
| InChIKey | MGRXFNCOVZGQEH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |