C17H20N2O5S — CID 129205176
tert-butyl 1-cyano-5-(2-methoxyethylsulfonyl)isoindole-2-carboxylate (PubChem CID 129205176) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is tert-butyl 1-cyano-5-(2-methoxyethylsulfonyl)isoindole-2-carboxylate.
| Compound Name | tert-butyl 1-cyano-5-(2-methoxyethylsulfonyl)isoindole-2-carboxylate |
|---|---|
| PubChem CID | 129205176 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | tert-butyl 1-cyano-5-(2-methoxyethylsulfonyl)isoindole-2-carboxylate |
| SMILES | COCCS(=O)(=O)c1ccc2c(C#N)n(C(=O)OC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C17H20N2O5S/c1-17(2,3)24-16(20)19-11-12-9-13(25(21,22)8-7-23-4)5-6-14(12)15(19)10-18/h5-6,9,11H,7-8H2,1-4H3 |
| InChIKey | XGDSNEUUNPTMQJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |