C18H19NO4S — CID 66853285
tert-butyl 3-(6-cyanonaphthalen-2-yl)sulfonylpropanoate (PubChem CID 66853285) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is tert-butyl 3-(6-cyanonaphthalen-2-yl)sulfonylpropanoate.
| Compound Name | tert-butyl 3-(6-cyanonaphthalen-2-yl)sulfonylpropanoate |
|---|---|
| PubChem CID | 66853285 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | tert-butyl 3-(6-cyanonaphthalen-2-yl)sulfonylpropanoate |
| SMILES | CC(C)(C)OC(=O)CCS(=O)(=O)c1ccc2cc(C#N)ccc2c1 |
| InChI | InChI=1S/C18H19NO4S/c1-18(2,3)23-17(20)8-9-24(21,22)16-7-6-14-10-13(12-19)4-5-15(14)11-16/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | OFDRLZGNXVPQAP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |