C16H21NO4S — CID 58559382
tert-butyl 4-(4-isocyano-3-methylphenyl)sulfonylbutanoate (PubChem CID 58559382) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is tert-butyl 4-(4-isocyano-3-methylphenyl)sulfonylbutanoate.
| Compound Name | tert-butyl 4-(4-isocyano-3-methylphenyl)sulfonylbutanoate |
|---|---|
| PubChem CID | 58559382 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | tert-butyl 4-(4-isocyano-3-methylphenyl)sulfonylbutanoate |
| SMILES | [C-]#[N+]c1ccc(S(=O)(=O)CCCC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C16H21NO4S/c1-12-11-13(8-9-14(12)17-5)22(19,20)10-6-7-15(18)21-16(2,3)4/h8-9,11H,6-7,10H2,1-4H3 |
| InChIKey | HXPGOLCKCDGFEY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|