C27H27F7N3O4S+ — CID 142495493
CID 142495493 (PubChem CID 142495493) has the molecular formula C27H27F7N3O4S+ and a molecular weight of 622.58 g/mol.
| Compound Name | CID 142495493 |
|---|---|
| PubChem CID | 142495493 |
| Molecular Formula | C27H27F7N3O4S+ |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | — |
| SMILES | CC(=O)N1Cc2cc([SH+](C)=O)ccc2C1C(=O)Nc1ccc(C(CC(=O)N2CC(C)(F)C2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H26F7N3O4S/c1-15(38)37-12-16-10-19(42(3)41)8-9-20(16)22(37)23(40)35-18-6-4-17(5-7-18)25(26(29,30)31,27(32,33)34)11-21(39)36-13-24(2,28)14-36/h4-10,22H,11-14H2,1-3H3,(H,35,40)/p+1 |
| InChIKey | SGSWCMPDBWRLJI-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|