C14H10F6N2O3 — CID 137368021
[1-amino-2-[7-(trifluoromethyl)quinolin-4-yl]oxyethyl] 2,2,2-trifluoroacetate (PubChem CID 137368021) has the molecular formula C14H10F6N2O3 and a molecular weight of 368.23 g/mol. Its IUPAC name is [1-amino-2-[7-(trifluoromethyl)quinolin-4-yl]oxyethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-amino-2-[7-(trifluoromethyl)quinolin-4-yl]oxyethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137368021 |
| Molecular Formula | C14H10F6N2O3 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [1-amino-2-[7-(trifluoromethyl)quinolin-4-yl]oxyethyl] 2,2,2-trifluoroacetate |
| SMILES | NC(COc1ccnc2cc(C(F)(F)F)ccc12)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H10F6N2O3/c15-13(16,17)7-1-2-8-9(5-7)22-4-3-10(8)24-6-11(21)25-12(23)14(18,19)20/h1-5,11H,6,21H2 |
| InChIKey | KHZZSQZGPGUNHO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|