C23H19F9O4S — CID 137370228
[6-[2,3-difluoro-4-(4-propylcyclohexen-1-yl)phenyl]-2-fluoro-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate (PubChem CID 137370228) has the molecular formula C23H19F9O4S and a molecular weight of 562.45 g/mol. Its IUPAC name is [6-[2,3-difluoro-4-(4-propylcyclohexen-1-yl)phenyl]-2-fluoro-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [6-[2,3-difluoro-4-(4-propylcyclohexen-1-yl)phenyl]-2-fluoro-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 137370228 |
| Molecular Formula | C23H19F9O4S |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | [6-[2,3-difluoro-4-(4-propylcyclohexen-1-yl)phenyl]-2-fluoro-3-(trifluoromethoxy)phenyl] trifluoromethanesulfonate |
| SMILES | CCCC1CC=C(c2ccc(-c3ccc(OC(F)(F)F)c(F)c3OS(=O)(=O)C(F)(F)F)c(F)c2F)CC1 |
| InChI | InChI=1S/C23H19F9O4S/c1-2-3-12-4-6-13(7-5-12)14-8-9-15(19(25)18(14)24)16-10-11-17(35-22(27,28)29)20(26)21(16)36-37(33,34)23(30,31)32/h6,8-12H,2-5,7H2,1H3 |
| InChIKey | GFGCQKNTJAUCQB-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|