C28H29F7O3S — CID 168864035
[6-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenyl]-2,3-difluorophenyl] trifluoromethanesulfonate (PubChem CID 168864035) has the molecular formula C28H29F7O3S and a molecular weight of 578.59 g/mol. Its IUPAC name is [6-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenyl]-2,3-difluorophenyl] trifluoromethanesulfonate.
| Compound Name | [6-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenyl]-2,3-difluorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168864035 |
| Molecular Formula | C28H29F7O3S |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | [6-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenyl]-2,3-difluorophenyl] trifluoromethanesulfonate |
| SMILES | CCCC1CCC(C2CC=C(c3ccc(-c4ccc(F)c(F)c4OS(=O)(=O)C(F)(F)F)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C28H29F7O3S/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-13-21(25(31)24(20)30)22-14-15-23(29)26(32)27(22)38-39(36,37)28(33,34)35/h10,12-18H,2-9,11H2,1H3 |
| InChIKey | SAIODVYUHXNACZ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|