C22H23N3O4 — CID 137371797
[3-[3-(2-methoxypyrimidin-4-yl)phenoxy]-3-phenylpropyl]-methylcarbamic acid (PubChem CID 137371797) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [3-[3-(2-methoxypyrimidin-4-yl)phenoxy]-3-phenylpropyl]-methylcarbamic acid.
| Compound Name | [3-[3-(2-methoxypyrimidin-4-yl)phenoxy]-3-phenylpropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 137371797 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [3-[3-(2-methoxypyrimidin-4-yl)phenoxy]-3-phenylpropyl]-methylcarbamic acid |
| SMILES | COc1nccc(-c2cccc(OC(CCN(C)C(=O)O)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C22H23N3O4/c1-25(22(26)27)14-12-20(16-7-4-3-5-8-16)29-18-10-6-9-17(15-18)19-11-13-23-21(24-19)28-2/h3-11,13,15,20H,12,14H2,1-2H3,(H,26,27) |
| InChIKey | DIUUVKKBOQNWLX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |