C21H13F2N5 — CID 137372584
6-(4-fluorophenyl)-5-(2-fluoroquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 137372584) has the molecular formula C21H13F2N5 and a molecular weight of 373.37 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-5-(2-fluoroquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(4-fluorophenyl)-5-(2-fluoroquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 137372584 |
| Molecular Formula | C21H13F2N5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-(4-fluorophenyl)-5-(2-fluoroquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(-c2ccc3nc(F)ccc3c2)n2ccnc12 |
| InChI | InChI=1S/C21H13F2N5/c22-15-5-1-12(2-6-15)18-19(28-10-9-25-21(28)20(24)27-18)14-3-7-16-13(11-14)4-8-17(23)26-16/h1-11H,(H2,24,27) |
| InChIKey | DKUPUZJUQKXGQK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|