C22H13FN6 — CID 155642592
6-(3-fluorophenyl)-5-(8-isocyanoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 155642592) has the molecular formula C22H13FN6 and a molecular weight of 380.39 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-5-(8-isocyanoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(3-fluorophenyl)-5-(8-isocyanoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 155642592 |
| Molecular Formula | C22H13FN6 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 6-(3-fluorophenyl)-5-(8-isocyanoquinolin-6-yl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | [C-]#[N+]c1cc(-c2c(-c3cccc(F)c3)nc(N)c3nccn23)cc2cccnc12 |
| InChI | InChI=1S/C22H13FN6/c1-25-17-12-15(10-13-5-3-7-26-18(13)17)20-19(14-4-2-6-16(23)11-14)28-21(24)22-27-8-9-29(20)22/h2-12H,(H2,24,28) |
| InChIKey | LYGPISBRNYFPIX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|