C24H22F2N4O — CID 137373638
7-[3-[1-(cyclopentylmethyl)pyrazol-4-yl]-6-(difluoromethoxy)-2-pyridinyl]quinoline (PubChem CID 137373638) has the molecular formula C24H22F2N4O and a molecular weight of 420.46 g/mol. Its IUPAC name is 7-[3-[1-(cyclopentylmethyl)pyrazol-4-yl]-6-(difluoromethoxy)-2-pyridinyl]quinoline.
| Compound Name | 7-[3-[1-(cyclopentylmethyl)pyrazol-4-yl]-6-(difluoromethoxy)-2-pyridinyl]quinoline |
|---|---|
| PubChem CID | 137373638 |
| Molecular Formula | C24H22F2N4O |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 7-[3-[1-(cyclopentylmethyl)pyrazol-4-yl]-6-(difluoromethoxy)-2-pyridinyl]quinoline |
| SMILES | FC(F)Oc1ccc(-c2cnn(CC3CCCC3)c2)c(-c2ccc3cccnc3c2)n1 |
| InChI | InChI=1S/C24H22F2N4O/c25-24(26)31-22-10-9-20(19-13-28-30(15-19)14-16-4-1-2-5-16)23(29-22)18-8-7-17-6-3-11-27-21(17)12-18/h3,6-13,15-16,24H,1-2,4-5,14H2 |
| InChIKey | DBCHFGRKSHPDLJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |