C22H19N5 — CID 162502519
7-[6-isocyano-3-[1-(2-methylpropyl)pyrazol-4-yl]-2-pyridinyl]quinoline (PubChem CID 162502519) has the molecular formula C22H19N5 and a molecular weight of 353.43 g/mol. Its IUPAC name is 7-[6-isocyano-3-[1-(2-methylpropyl)pyrazol-4-yl]-2-pyridinyl]quinoline.
| Compound Name | 7-[6-isocyano-3-[1-(2-methylpropyl)pyrazol-4-yl]-2-pyridinyl]quinoline |
|---|---|
| PubChem CID | 162502519 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 7-[6-isocyano-3-[1-(2-methylpropyl)pyrazol-4-yl]-2-pyridinyl]quinoline |
| SMILES | [C-]#[N+]c1ccc(-c2cnn(CC(C)C)c2)c(-c2ccc3cccnc3c2)n1 |
| InChI | InChI=1S/C22H19N5/c1-15(2)13-27-14-18(12-25-27)19-8-9-21(23-3)26-22(19)17-7-6-16-5-4-10-24-20(16)11-17/h4-12,14-15H,13H2,1-2H3 |
| InChIKey | BYVMXCVGEPIYPQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|