C23H15F4N5 — CID 162502545
7-[3-[5-fluoro-1-[[1-(trifluoromethyl)cyclopropyl]methyl]pyrazol-4-yl]-6-isocyano-2-pyridinyl]quinoline (PubChem CID 162502545) has the molecular formula C23H15F4N5 and a molecular weight of 437.40 g/mol. Its IUPAC name is 7-[3-[5-fluoro-1-[[1-(trifluoromethyl)cyclopropyl]methyl]pyrazol-4-yl]-6-isocyano-2-pyridinyl]quinoline.
| Compound Name | 7-[3-[5-fluoro-1-[[1-(trifluoromethyl)cyclopropyl]methyl]pyrazol-4-yl]-6-isocyano-2-pyridinyl]quinoline |
|---|---|
| PubChem CID | 162502545 |
| Molecular Formula | C23H15F4N5 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 7-[3-[5-fluoro-1-[[1-(trifluoromethyl)cyclopropyl]methyl]pyrazol-4-yl]-6-isocyano-2-pyridinyl]quinoline |
| SMILES | [C-]#[N+]c1ccc(-c2cnn(CC3(C(F)(F)F)CC3)c2F)c(-c2ccc3cccnc3c2)n1 |
| InChI | InChI=1S/C23H15F4N5/c1-28-19-7-6-16(20(31-19)15-5-4-14-3-2-10-29-18(14)11-15)17-12-30-32(21(17)24)13-22(8-9-22)23(25,26)27/h2-7,10-12H,8-9,13H2 |
| InChIKey | OAFKBAMJQBMZTP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|