C23H19F2N5O — CID 162502564
3,3-difluoro-4-[4-(6-isocyano-2-quinolin-7-yl-3-pyridinyl)pyrazol-1-yl]-2-methylbutan-2-ol (PubChem CID 162502564) has the molecular formula C23H19F2N5O and a molecular weight of 419.44 g/mol. Its IUPAC name is 3,3-difluoro-4-[4-(6-isocyano-2-quinolin-7-yl-3-pyridinyl)pyrazol-1-yl]-2-methylbutan-2-ol.
| Compound Name | 3,3-difluoro-4-[4-(6-isocyano-2-quinolin-7-yl-3-pyridinyl)pyrazol-1-yl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 162502564 |
| Molecular Formula | C23H19F2N5O |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3,3-difluoro-4-[4-(6-isocyano-2-quinolin-7-yl-3-pyridinyl)pyrazol-1-yl]-2-methylbutan-2-ol |
| SMILES | [C-]#[N+]c1ccc(-c2cnn(CC(F)(F)C(C)(C)O)c2)c(-c2ccc3cccnc3c2)n1 |
| InChI | InChI=1S/C23H19F2N5O/c1-22(2,31)23(24,25)14-30-13-17(12-28-30)18-8-9-20(26-3)29-21(18)16-7-6-15-5-4-10-27-19(15)11-16/h4-13,31H,14H2,1-2H3 |
| InChIKey | ALPZGVPLWVWTLT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 68.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|