C18H24N6O — CID 137381027
N-[5-[(dimethylamino)methyl]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 137381027) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[5-[(dimethylamino)methyl]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[5-[(dimethylamino)methyl]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137381027 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | N-[5-[(dimethylamino)methyl]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(CN(C)C)ccc1Nc1cc(N(C)C)ncn1 |
| InChI | InChI=1S/C18H24N6O/c1-6-18(25)22-15-9-13(11-23(2)3)7-8-14(15)21-16-10-17(24(4)5)20-12-19-16/h6-10,12H,1,11H2,2-5H3,(H,22,25)(H,19,20,21) |
| InChIKey | OHPFBCFBPSIPAY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|