C21H32N4O6 — CID 137381329
4,13,16,17-tetramethyl-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosane-2,6,12,15,18-pentone (PubChem CID 137381329) has the molecular formula C21H32N4O6 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4,13,16,17-tetramethyl-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosane-2,6,12,15,18-pentone.
| Compound Name | 4,13,16,17-tetramethyl-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosane-2,6,12,15,18-pentone |
|---|---|
| PubChem CID | 137381329 |
| Molecular Formula | C21H32N4O6 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4,13,16,17-tetramethyl-5-oxa-1,11,14,17-tetrazatricyclo[17.3.0.07,11]docosane-2,6,12,15,18-pentone |
| SMILES | CC1CC(=O)N2CCCC2C(=O)N(C)C(C)C(=O)NC(C)C(=O)N2CCCC2C(=O)O1 |
| InChI | InChI=1S/C21H32N4O6/c1-12-11-17(26)24-9-5-7-15(24)20(29)23(4)14(3)18(27)22-13(2)19(28)25-10-6-8-16(25)21(30)31-12/h12-16H,5-11H2,1-4H3,(H,22,27) |
| InChIKey | UHEVFKXEALLOLX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |