C24H38N4O5 — CID 137381623
10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,18,21-tetrone (PubChem CID 137381623) has the molecular formula C24H38N4O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is 10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,18,21-tetrone.
| Compound Name | 10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,18,21-tetrone |
|---|---|
| PubChem CID | 137381623 |
| Molecular Formula | C24H38N4O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,18,21-tetrone |
| SMILES | CC1CC2COC(C)CC(=O)N3CCCC3C(=O)N3CCCCC3C(=O)NC(C)C(=O)N2C1 |
| InChI | InChI=1S/C24H38N4O5/c1-15-11-18-14-33-16(2)12-21(29)26-10-6-8-20(26)24(32)27-9-5-4-7-19(27)22(30)25-17(3)23(31)28(18)13-15/h15-20H,4-14H2,1-3H3,(H,25,30) |
| InChIKey | BSIOFAUWEYRVDX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |