C23H34N4O7 — CID 167146721
(3S,5R,15R)-5-hydroxy-15,19-dimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone (PubChem CID 167146721) has the molecular formula C23H34N4O7 and a molecular weight of 478.55 g/mol. Its IUPAC name is (3S,5R,15R)-5-hydroxy-15,19-dimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone.
| Compound Name | (3S,5R,15R)-5-hydroxy-15,19-dimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone |
|---|---|
| PubChem CID | 167146721 |
| Molecular Formula | C23H34N4O7 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (3S,5R,15R)-5-hydroxy-15,19-dimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone |
| SMILES | CC1NC(=O)C2CCCCN2C(=O)[C@@H]2C[C@@H](O)CN2C(=O)CCOC(=O)C2C[C@@H](C)CN2C1=O |
| InChI | InChI=1S/C23H34N4O7/c1-13-9-18-23(33)34-8-6-19(29)26-12-15(28)10-17(26)22(32)25-7-4-3-5-16(25)20(30)24-14(2)21(31)27(18)11-13/h13-18,28H,3-12H2,1-2H3,(H,24,30)/t13-,14?,15-,16?,17+,18?/m1/s1 |
| InChIKey | YQUSUSRBGPPJAG-BSCPHDMESA-N |
| XLogP | -0.98 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |