C24H36N4O6 — CID 137381504
(3S)-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone (PubChem CID 137381504) has the molecular formula C24H36N4O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is (3S)-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone.
| Compound Name | (3S)-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone |
|---|---|
| PubChem CID | 137381504 |
| Molecular Formula | C24H36N4O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (3S)-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone |
| SMILES | CC1CC2C(=O)OC(C)CC(=O)N3CCC[C@H]3C(=O)N3CCCCC3C(=O)NC(C)C(=O)N2C1 |
| InChI | InChI=1S/C24H36N4O6/c1-14-11-19-24(33)34-15(2)12-20(29)26-10-6-8-18(26)23(32)27-9-5-4-7-17(27)21(30)25-16(3)22(31)28(19)13-14/h14-19H,4-13H2,1-3H3,(H,25,30)/t14?,15?,16?,17?,18-,19?/m0/s1 |
| InChIKey | UBPSAXPRQIXKIR-YXOSVLIBSA-N |
| XLogP | 0.44 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |