C24H37N5O6 — CID 144801428
(3S,9S,10S,13S,15R,19S,22S)-9-amino-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone (PubChem CID 144801428) has the molecular formula C24H37N5O6 and a molecular weight of 491.59 g/mol. Its IUPAC name is (3S,9S,10S,13S,15R,19S,22S)-9-amino-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone.
| Compound Name | (3S,9S,10S,13S,15R,19S,22S)-9-amino-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone |
|---|---|
| PubChem CID | 144801428 |
| Molecular Formula | C24H37N5O6 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (3S,9S,10S,13S,15R,19S,22S)-9-amino-10,15,19-trimethyl-11-oxa-1,7,17,20-tetrazatetracyclo[20.4.0.03,7.013,17]hexacosane-2,8,12,18,21-pentone |
| SMILES | C[C@@H]1C[C@H]2C(=O)O[C@@H](C)[C@H](N)C(=O)N3CCC[C@H]3C(=O)N3CCCC[C@H]3C(=O)N[C@@H](C)C(=O)N2C1 |
| InChI | InChI=1S/C24H37N5O6/c1-13-11-18-24(34)35-15(3)19(25)23(33)28-10-6-8-17(28)22(32)27-9-5-4-7-16(27)20(30)26-14(2)21(31)29(18)12-13/h13-19H,4-12,25H2,1-3H3,(H,26,30)/t13-,14+,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | OFSVPBKKOUFTIQ-KYQPOWKGSA-N |
| XLogP | -0.63 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |