C21H21FN4O4S2 — CID 137382393
3-[1-(3-amino-2-methylphenyl)butyl]-5-fluoro-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide (PubChem CID 137382393) has the molecular formula C21H21FN4O4S2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 3-[1-(3-amino-2-methylphenyl)butyl]-5-fluoro-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 3-[1-(3-amino-2-methylphenyl)butyl]-5-fluoro-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 137382393 |
| Molecular Formula | C21H21FN4O4S2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 3-[1-(3-amino-2-methylphenyl)butyl]-5-fluoro-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCCC(c1cccc(N)c1C)n1c(=O)oc2cc(S(=O)(=O)Nc3nccs3)c(F)cc21 |
| InChI | InChI=1S/C21H21FN4O4S2/c1-3-5-16(13-6-4-7-15(23)12(13)2)26-17-10-14(22)19(11-18(17)30-21(26)27)32(28,29)25-20-24-8-9-31-20/h4,6-11,16H,3,5,23H2,1-2H3,(H,24,25) |
| InChIKey | CDPAHSPCEWELBX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|