C21H13F2N3O5S2 — CID 137369749
5-fluoro-3-(5-fluoro-1-formyl-4H-naphthalen-1-yl)-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide (PubChem CID 137369749) has the molecular formula C21H13F2N3O5S2 and a molecular weight of 489.48 g/mol. Its IUPAC name is 5-fluoro-3-(5-fluoro-1-formyl-4H-naphthalen-1-yl)-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 5-fluoro-3-(5-fluoro-1-formyl-4H-naphthalen-1-yl)-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 137369749 |
| Molecular Formula | C21H13F2N3O5S2 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 5-fluoro-3-(5-fluoro-1-formyl-4H-naphthalen-1-yl)-2-oxo-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-sulfonamide |
| SMILES | O=CC1(n2c(=O)oc3cc(S(=O)(=O)Nc4nccs4)c(F)cc32)C=CCc2c(F)cccc21 |
| InChI | InChI=1S/C21H13F2N3O5S2/c22-14-5-1-4-13-12(14)3-2-6-21(13,11-27)26-16-9-15(23)18(10-17(16)31-20(26)28)33(29,30)25-19-24-7-8-32-19/h1-2,4-11H,3H2,(H,24,25) |
| InChIKey | YYVICMOTRAHQPP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|