C13H26N2 — CID 137384996
(Z,3S)-3-N-[(Z)-hept-3-en-4-yl]-2-methylpent-1-ene-1,3-diamine (PubChem CID 137384996) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z,3S)-3-N-[(Z)-hept-3-en-4-yl]-2-methylpent-1-ene-1,3-diamine.
| Compound Name | (Z,3S)-3-N-[(Z)-hept-3-en-4-yl]-2-methylpent-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 137384996 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (Z,3S)-3-N-[(Z)-hept-3-en-4-yl]-2-methylpent-1-ene-1,3-diamine |
| SMILES | CC/C=C(/CCC)N[C@@H](CC)/C(C)=C\N |
| InChI | InChI=1S/C13H26N2/c1-5-8-12(9-6-2)15-13(7-3)11(4)10-14/h8,10,13,15H,5-7,9,14H2,1-4H3/b11-10-,12-8-/t13-/m0/s1 |
| InChIKey | UDJHVRIOQPLELP-SQPSOSRSSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |