C24H47N5 — CID 142216742
2-[1-[(Z)-5-(pent-1-en-3-ylamino)oct-5-enyl]iminobutan-2-ylamino]-N'-propylbutanimidamide (PubChem CID 142216742) has the molecular formula C24H47N5 and a molecular weight of 405.68 g/mol. Its IUPAC name is 2-[1-[(Z)-5-(pent-1-en-3-ylamino)oct-5-enyl]iminobutan-2-ylamino]-N'-propylbutanimidamide.
| Compound Name | 2-[1-[(Z)-5-(pent-1-en-3-ylamino)oct-5-enyl]iminobutan-2-ylamino]-N'-propylbutanimidamide |
|---|---|
| PubChem CID | 142216742 |
| Molecular Formula | C24H47N5 |
| Molecular Weight | 405.68 g/mol |
| Exact Mass | 405.38 |
| IUPAC Name | 2-[1-[(Z)-5-(pent-1-en-3-ylamino)oct-5-enyl]iminobutan-2-ylamino]-N'-propylbutanimidamide |
| SMILES | C=CC(CC)N/C(=C\CC)CCCC/N=C/C(CC)NC(CC)/C(N)=N/CCC |
| InChI | InChI=1S/C24H47N5/c1-7-15-22(28-20(9-3)10-4)16-13-14-18-26-19-21(11-5)29-23(12-6)24(25)27-17-8-2/h9,15,19-21,23,28-29H,3,7-8,10-14,16-18H2,1-2,4-6H3,(H2,25,27)/b22-15-,26-19+ |
| InChIKey | JMBZQKCNLMKVOT-AIICTDHCSA-N |
| XLogP | 4.99 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|