C17H24N6O3S — CID 137387050
N-[2-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]amino]propan-2-yl]methanesulfonamide (PubChem CID 137387050) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[2-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]amino]propan-2-yl]methanesulfonamide.
| Compound Name | N-[2-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]amino]propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 137387050 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[2-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]amino]propan-2-yl]methanesulfonamide |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1NC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C17H24N6O3S/c1-5-26-10-13-20-14-15(11-8-6-7-9-12(11)19-16(14)18)23(13)21-17(2,3)22-27(4,24)25/h6-9,21-22H,5,10H2,1-4H3,(H2,18,19) |
| InChIKey | VAGWHIPVLCCHEP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|