C21H29ClN6O3 — CID 137388029
tert-butyl N-[4-[[2-chloro-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]amino]-2-methylphenyl]-N-(methylideneamino)carbamate (PubChem CID 137388029) has the molecular formula C21H29ClN6O3 and a molecular weight of 448.96 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-chloro-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]amino]-2-methylphenyl]-N-(methylideneamino)carbamate.
| Compound Name | tert-butyl N-[4-[[2-chloro-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]amino]-2-methylphenyl]-N-(methylideneamino)carbamate |
|---|---|
| PubChem CID | 137388029 |
| Molecular Formula | C21H29ClN6O3 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | tert-butyl N-[4-[[2-chloro-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]amino]-2-methylphenyl]-N-(methylideneamino)carbamate |
| SMILES | C=NN(C(=O)OC(C)(C)C)c1ccc(Nc2cc(OCCN(C)C)nc(Cl)n2)cc1C |
| InChI | InChI=1S/C21H29ClN6O3/c1-14-12-15(8-9-16(14)28(23-5)20(29)31-21(2,3)4)24-17-13-18(26-19(22)25-17)30-11-10-27(6)7/h8-9,12-13H,5,10-11H2,1-4,6-7H3,(H,24,25,26) |
| InChIKey | PKCKOLMHRBUNGX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|